About 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine
6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine (PubChem CID 59910602) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine.
Analyze 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine?
The IUPAC name of 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine (CID 59910602) is 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine.
What is the SMILES notation for 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine?
The canonical SMILES for 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine is CC1CC2C=CN=CC2C1.
What is the InChIKey of 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine?
The InChIKey is COEACNVXNOABHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-7-4-8-2-3-10-6-9(8)5-7/h2-3,6-9H,4-5H2,1H3.
What are the key properties of 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine?
6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine has a molecular weight of 135.21 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridine is sourced from PubChem (CID 59910602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).