C33H40FN3O2 — CID 59910646
N-[(1R)-1-[(4S,5S)-5-[(1R)-1-[(4-fluoro-3-isocyanophenyl)methylamino]-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]butan-1-amine (PubChem CID 59910646) has the molecular formula C33H40FN3O2 and a molecular weight of 529.70 g/mol. Its IUPAC name is N-[(1R)-1-[(4S,5S)-5-[(1R)-1-[(4-fluoro-3-isocyanophenyl)methylamino]-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]butan-1-amine.
| Compound Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-[(4-fluoro-3-isocyanophenyl)methylamino]-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]butan-1-amine |
|---|---|
| PubChem CID | 59910646 |
| Molecular Formula | C33H40FN3O2 |
| Molecular Weight | 529.70 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | N-[(1R)-1-[(4S,5S)-5-[(1R)-1-[(4-fluoro-3-isocyanophenyl)methylamino]-2-phenylethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-phenylethyl]butan-1-amine |
| SMILES | [C-]#[N+]c1cc(CN[C@H](Cc2ccccc2)[C@@H]2OC(C)(C)O[C@H]2[C@@H](Cc2ccccc2)NCCCC)ccc1F |
| InChI | InChI=1S/C33H40FN3O2/c1-5-6-19-36-29(20-24-13-9-7-10-14-24)31-32(39-33(2,3)38-31)30(21-25-15-11-8-12-16-25)37-23-26-17-18-27(34)28(22-26)35-4/h7-18,22,29-32,36-37H,5-6,19-21,23H2,1-3H3/t29-,30-,31+,32+/m1/s1 |
| InChIKey | AUBVTXRMEWHRHN-ZRTHHSRSSA-N |
| XLogP | 6.60 |
| TPSA | 46.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.70 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|