C29H42F2O5 — CID 59910715
propan-2-yl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxo-6-phenylhexyl)-3-hydroxy-5-oxocyclopentyl]nonanoate (PubChem CID 59910715) has the molecular formula C29H42F2O5 and a molecular weight of 508.65 g/mol. Its IUPAC name is propan-2-yl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxo-6-phenylhexyl)-3-hydroxy-5-oxocyclopentyl]nonanoate.
| Compound Name | propan-2-yl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxo-6-phenylhexyl)-3-hydroxy-5-oxocyclopentyl]nonanoate |
|---|---|
| PubChem CID | 59910715 |
| Molecular Formula | C29H42F2O5 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | propan-2-yl 9-[(1R,2R,3R)-2-(4,4-difluoro-3-oxo-6-phenylhexyl)-3-hydroxy-5-oxocyclopentyl]nonanoate |
| SMILES | CC(C)OC(=O)CCCCCCCC[C@H]1C(=O)C[C@@H](O)[C@@H]1CCC(=O)C(F)(F)CCc1ccccc1 |
| InChI | InChI=1S/C29H42F2O5/c1-21(2)36-28(35)15-11-6-4-3-5-10-14-23-24(26(33)20-25(23)32)16-17-27(34)29(30,31)19-18-22-12-8-7-9-13-22/h7-9,12-13,21,23-24,26,33H,3-6,10-11,14-20H2,1-2H3/t23-,24-,26-/m1/s1 |
| InChIKey | LTMCMOOVVAHIQN-DGWZTRNLSA-N |
| XLogP | 6.24 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|