C38H72F2O6Si — CID 59910743
propan-2-yl 9-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]nonanoate (PubChem CID 59910743) has the molecular formula C38H72F2O6Si and a molecular weight of 691.07 g/mol. Its IUPAC name is propan-2-yl 9-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]nonanoate.
| Compound Name | propan-2-yl 9-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]nonanoate |
|---|---|
| PubChem CID | 59910743 |
| Molecular Formula | C38H72F2O6Si |
| Molecular Weight | 691.07 g/mol |
| Exact Mass | 690.51 |
| IUPAC Name | propan-2-yl 9-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-difluorodecyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]nonanoate |
| SMILES | CCCCCCC(F)(F)C(CC[C@@H]1[C@@H](CCCCCCCCC(=O)OC(C)C)[C@@H](O)C[C@H]1OC1CCCCO1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H72F2O6Si/c1-9-10-11-19-26-38(39,40)34(46-47(7,8)37(4,5)6)25-24-31-30(32(41)28-33(31)45-36-23-18-20-27-43-36)21-16-14-12-13-15-17-22-35(42)44-29(2)3/h29-34,36,41H,9-28H2,1-8H3/t30-,31-,32+,33-,34?,36?/m1/s1 |
| InChIKey | YALAEXSKLNENJH-ZULWWADJSA-N |
| XLogP | 10.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.07 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|