About (E)-2,3-difluoro-4-methylpent-2-ene
(E)-2,3-difluoro-4-methylpent-2-ene (PubChem CID 59910994) has the molecular formula C6H10F2
and a molecular weight of 120.14 g/mol. Its IUPAC name is (E)-2,3-difluoro-4-methylpent-2-ene.
Molecular Properties
| Compound Name | (E)-2,3-difluoro-4-methylpent-2-ene |
| PubChem CID | 59910994 |
| Molecular Formula | C6H10F2 |
| Molecular Weight | 120.14 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | (E)-2,3-difluoro-4-methylpent-2-ene |
| SMILES | C/C(F)=C(\F)C(C)C |
| InChI | InChI=1S/C6H10F2/c1-4(2)6(8)5(3)7/h4H,1-3H3/b6-5+ |
| InChIKey | BVPTWMWBALMFQU-AATRIKPKSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (E)-2,3-difluoro-4-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-difluoro-4-methylpent-2-ene?
The IUPAC name of (E)-2,3-difluoro-4-methylpent-2-ene (CID 59910994) is (E)-2,3-difluoro-4-methylpent-2-ene.
What is the SMILES notation for (E)-2,3-difluoro-4-methylpent-2-ene?
The canonical SMILES for (E)-2,3-difluoro-4-methylpent-2-ene is C/C(F)=C(\F)C(C)C.
What is the InChIKey of (E)-2,3-difluoro-4-methylpent-2-ene?
The InChIKey is BVPTWMWBALMFQU-AATRIKPKSA-N. The full InChI is InChI=1S/C6H10F2/c1-4(2)6(8)5(3)7/h4H,1-3H3/b6-5+.
What are the key properties of (E)-2,3-difluoro-4-methylpent-2-ene?
(E)-2,3-difluoro-4-methylpent-2-ene has a molecular weight of 120.14 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-difluoro-4-methylpent-2-ene is sourced from PubChem (CID 59910994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).