About (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene
(Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene (PubChem CID 59910997) has the molecular formula C7H10ClF3
and a molecular weight of 186.60 g/mol. Its IUPAC name is (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene.
Molecular Properties
| Compound Name | (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene |
| PubChem CID | 59910997 |
| Molecular Formula | C7H10ClF3 |
| Molecular Weight | 186.60 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene |
| SMILES | C/C(=C(/Cl)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C7H10ClF3/c1-4(2)5(3)6(8)7(9,10)11/h4H,1-3H3/b6-5- |
| InChIKey | KXRYHPRIDUCUOS-WAYWQWQTSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.60 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The IUPAC name of (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene (CID 59910997) is (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene.
What is the SMILES notation for (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The canonical SMILES for (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene is C/C(=C(/Cl)C(F)(F)F)C(C)C.
What is the InChIKey of (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
The InChIKey is KXRYHPRIDUCUOS-WAYWQWQTSA-N. The full InChI is InChI=1S/C7H10ClF3/c1-4(2)5(3)6(8)7(9,10)11/h4H,1-3H3/b6-5-.
What are the key properties of (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene?
(Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene has a molecular weight of 186.60 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-chloro-1,1,1-trifluoro-3,4-dimethylpent-2-ene is sourced from PubChem (CID 59910997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).