C14H26N2O3 — CID 59911040
(2R,4S)-5-(1-amino-2-methoxy-2-methylbutyl)-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid (PubChem CID 59911040) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is (2R,4S)-5-(1-amino-2-methoxy-2-methylbutyl)-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S)-5-(1-amino-2-methoxy-2-methylbutyl)-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59911040 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | (2R,4S)-5-(1-amino-2-methoxy-2-methylbutyl)-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)O)NC1C(N)C(C)(CC)OC |
| InChI | InChI=1S/C14H26N2O3/c1-5-7-9-8-10(13(17)18)16-11(9)12(15)14(3,6-2)19-4/h5,7,9-12,16H,6,8,15H2,1-4H3,(H,17,18)/b7-5-/t9-,10-,11?,12?,14?/m1/s1 |
| InChIKey | RIKOXWKDYOTWDX-IRINHKIXSA-N |
| XLogP | 1.14 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|