C8H16 — CID 59911217
(3R)-2,3,4-trimethylpent-1-ene (PubChem CID 59911217) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is (3R)-2,3,4-trimethylpent-1-ene.
| Compound Name | (3R)-2,3,4-trimethylpent-1-ene |
|---|---|
| PubChem CID | 59911217 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | (3R)-2,3,4-trimethylpent-1-ene |
| SMILES | C=C(C)[C@H](C)C(C)C |
| InChI | InChI=1S/C8H16/c1-6(2)8(5)7(3)4/h7-8H,1H2,2-5H3/t8-/m0/s1 |
| InChIKey | FAWUHEYSSPPNSH-QMMMGPOBSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|