C27H29Cl2N7O9S2 — CID 59911785
4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfophenyl)-3-methylpyrazol-5-yl]diazenyl]-N-(4-sulfobutyl)anilino]butanoic acid (PubChem CID 59911785) has the molecular formula C27H29Cl2N7O9S2 and a molecular weight of 730.61 g/mol. Its IUPAC name is 4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfophenyl)-3-methylpyrazol-5-yl]diazenyl]-N-(4-sulfobutyl)anilino]butanoic acid.
| Compound Name | 4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfophenyl)-3-methylpyrazol-5-yl]diazenyl]-N-(4-sulfobutyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 59911785 |
| Molecular Formula | C27H29Cl2N7O9S2 |
| Molecular Weight | 730.61 g/mol |
| Exact Mass | 729.08 |
| IUPAC Name | 4-[3-acetamido-4-[[4-cyano-1-(2,6-dichloro-4-sulfophenyl)-3-methylpyrazol-5-yl]diazenyl]-N-(4-sulfobutyl)anilino]butanoic acid |
| SMILES | CC(=O)Nc1cc(N(CCCCS(=O)(=O)O)CCCC(=O)O)ccc1/N=N/c1c(C#N)c(C)nn1-c1c(Cl)cc(S(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C27H29Cl2N7O9S2/c1-16-20(15-30)27(36(34-16)26-21(28)13-19(14-22(26)29)47(43,44)45)33-32-23-8-7-18(12-24(23)31-17(2)37)35(10-5-6-25(38)39)9-3-4-11-46(40,41)42/h7-8,12-14H,3-6,9-11H2,1-2H3,(H,31,37)(H,38,39)(H,40,41,42)(H,43,44,45)/b33-32+ |
| InChIKey | IKPUVFZSWTUUCP-ULIFNZDWSA-N |
| XLogP | 5.32 |
| TPSA | 244.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|