C10H10F12O3 — CID 59911895
1,1,1,5,5,5-hexafluoro-4-(2-hydroxypropoxy)-2,4-bis(trifluoromethyl)pentan-2-ol (PubChem CID 59911895) has the molecular formula C10H10F12O3 and a molecular weight of 406.16 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-(2-hydroxypropoxy)-2,4-bis(trifluoromethyl)pentan-2-ol.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-(2-hydroxypropoxy)-2,4-bis(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 59911895 |
| Molecular Formula | C10H10F12O3 |
| Molecular Weight | 406.16 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-(2-hydroxypropoxy)-2,4-bis(trifluoromethyl)pentan-2-ol |
| SMILES | CC(O)COC(CC(O)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F12O3/c1-4(23)2-25-6(9(17,18)19,10(20,21)22)3-5(24,7(11,12)13)8(14,15)16/h4,23-24H,2-3H2,1H3 |
| InChIKey | WBYLHDNIAFSJAC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |