C9H3F16N — CID 59911903
2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylpiperidine (PubChem CID 59911903) has the molecular formula C9H3F16N and a molecular weight of 429.10 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylpiperidine.
| Compound Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylpiperidine |
|---|---|
| PubChem CID | 59911903 |
| Molecular Formula | C9H3F16N |
| Molecular Weight | 429.10 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 2,2,3,3,4,4,5,6,6-nonafluoro-1-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methylpiperidine |
| SMILES | CC1(F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H3F16N/c1-2(10)3(11,12)4(13,14)8(22,23)26(7(2,20)21)9(24,25)5(15,16)6(17,18)19/h1H3 |
| InChIKey | QBXNXRCFWFHQHO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.10 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|