About bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+)
bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) (PubChem CID 59911911) has the molecular formula C26H16Cl4N2NiS2
and a molecular weight of 621.07 g/mol. Its IUPAC name is bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+).
Molecular Properties
| Compound Name | bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) |
| PubChem CID | 59911911 |
| Molecular Formula | C26H16Cl4N2NiS2 |
| Molecular Weight | 621.07 g/mol |
| Exact Mass | 617.89 |
| IUPAC Name | bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) |
| SMILES | [Ni+2].[S-]c1ccccc1/N=C\c1ccc(Cl)c(Cl)c1.[S-]c1ccccc1/N=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/2C13H9Cl2NS.Ni/c2*14-10-6-5-9(7-11(10)15)8-16-12-3-1-2-4-13(12)17;/h2*1-8,17H;/q;;+2/p-2/b2*16-8-; |
| InChIKey | ONFZNVFTDZETQM-FWBJLZDUSA-L |
| XLogP | 9.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 621.07 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+)?
The IUPAC name of bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) (CID 59911911) is bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+).
What is the SMILES notation for bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+)?
The canonical SMILES for bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) is [Ni+2].[S-]c1ccccc1/N=C\c1ccc(Cl)c(Cl)c1.[S-]c1ccccc1/N=C\c1ccc(Cl)c(Cl)c1.
What is the InChIKey of bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+)?
The InChIKey is ONFZNVFTDZETQM-FWBJLZDUSA-L. The full InChI is InChI=1S/2C13H9Cl2NS.Ni/c2*14-10-6-5-9(7-11(10)15)8-16-12-3-1-2-4-13(12)17;/h2*1-8,17H;/q;;+2/p-2/b2*16-8-;.
What are the key properties of bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+)?
bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) has a molecular weight of 621.07 g/mol, XLogP of 9.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(3,4-dichlorophenyl)methylideneamino]benzenethiolate);nickel(2+) is sourced from PubChem (CID 59911911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).