C15H27NO6 — CID 59912082
(2S)-4-methyl-2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxypentanoic acid (PubChem CID 59912082) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxypentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxypentanoic acid |
|---|---|
| PubChem CID | 59912082 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2S)-4-methyl-2-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]oxypentanoic acid |
| SMILES | CC(C)C[C@H](OC(=O)C[C@@H](C)NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H27NO6/c1-9(2)7-11(13(18)19)21-12(17)8-10(3)16-14(20)22-15(4,5)6/h9-11H,7-8H2,1-6H3,(H,16,20)(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | ZFTMNOGDCATERV-MNOVXSKESA-N |
| XLogP | 2.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |