C20H30O4 — CID 59912146
(3E,5S,6S,7S,9R,11E,13E,15S,16R)-6-hydroxy-5,7,9,15,16-pentamethyl-1-oxacyclohexadeca-3,11,13-triene-2,10-dione (PubChem CID 59912146) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3E,5S,6S,7S,9R,11E,13E,15S,16R)-6-hydroxy-5,7,9,15,16-pentamethyl-1-oxacyclohexadeca-3,11,13-triene-2,10-dione.
| Compound Name | (3E,5S,6S,7S,9R,11E,13E,15S,16R)-6-hydroxy-5,7,9,15,16-pentamethyl-1-oxacyclohexadeca-3,11,13-triene-2,10-dione |
|---|---|
| PubChem CID | 59912146 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3E,5S,6S,7S,9R,11E,13E,15S,16R)-6-hydroxy-5,7,9,15,16-pentamethyl-1-oxacyclohexadeca-3,11,13-triene-2,10-dione |
| SMILES | C[C@@H]1C[C@H](C)[C@H](O)[C@@H](C)/C=C/C(=O)O[C@H](C)[C@@H](C)/C=C/C=C/C1=O |
| InChI | InChI=1S/C20H30O4/c1-13-8-6-7-9-18(21)15(3)12-16(4)20(23)14(2)10-11-19(22)24-17(13)5/h6-11,13-17,20,23H,12H2,1-5H3/b8-6+,9-7+,11-10+/t13-,14-,15+,16-,17+,20+/m0/s1 |
| InChIKey | WDMWTIKQIXSBFK-XBESBCJHSA-N |
| XLogP | 3.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |