C29H32F3N3O3 — CID 59912193
(4R)-4-ethyl-8-[3-[(1-hydroxy-4-methyl-2-pyridinylidene)amino]propoxy]-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-3-one (PubChem CID 59912193) has the molecular formula C29H32F3N3O3 and a molecular weight of 527.59 g/mol. Its IUPAC name is (4R)-4-ethyl-8-[3-[(1-hydroxy-4-methyl-2-pyridinylidene)amino]propoxy]-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-3-one.
| Compound Name | (4R)-4-ethyl-8-[3-[(1-hydroxy-4-methyl-2-pyridinylidene)amino]propoxy]-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-3-one |
|---|---|
| PubChem CID | 59912193 |
| Molecular Formula | C29H32F3N3O3 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (4R)-4-ethyl-8-[3-[(1-hydroxy-4-methyl-2-pyridinylidene)amino]propoxy]-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydro-1H-2-benzazepin-3-one |
| SMILES | CC[C@@H]1Cc2ccc(OCCC/N=c3/cc(C)ccn3O)cc2CN(Cc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C29H32F3N3O3/c1-3-22-16-23-7-10-26(38-14-4-12-33-27-15-20(2)11-13-35(27)37)17-24(23)19-34(28(22)36)18-21-5-8-25(9-6-21)29(30,31)32/h5-11,13,15,17,22,37H,3-4,12,14,16,18-19H2,1-2H3/b33-27-/t22-/m1/s1 |
| InChIKey | NUICGHFVDVGQDH-ZQLCYMSWSA-N |
| XLogP | 5.53 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|