C12H10NO- — CID 59912272
N-deca-2,4,5,6,7,8,9-heptaen-4-ylacetamide (PubChem CID 59912272) has the molecular formula C12H10NO- and a molecular weight of 184.22 g/mol. Its IUPAC name is N-deca-2,4,5,6,7,8,9-heptaen-4-ylacetamide.
| Compound Name | N-deca-2,4,5,6,7,8,9-heptaen-4-ylacetamide |
|---|---|
| PubChem CID | 59912272 |
| Molecular Formula | C12H10NO- |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N-deca-2,4,5,6,7,8,9-heptaen-4-ylacetamide |
| SMILES | [CH-]=C=C=C=C=C=C(C=CC)NC(C)=O |
| InChI | InChI=1S/C12H10NO/c1-4-6-7-8-10-12(9-5-2)13-11(3)14/h1,5,9H,2-3H3,(H,13,14)/q-1 |
| InChIKey | RZXKXDLTPXQZQV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|