About [methyl(propyl)-λ4-sulfanylidene]phosphane
[methyl(propyl)-λ4-sulfanylidene]phosphane (PubChem CID 59912307) has the molecular formula C4H11PS
and a molecular weight of 122.17 g/mol. Its IUPAC name is [methyl(propyl)-λ4-sulfanylidene]phosphane.
Molecular Properties
| Compound Name | [methyl(propyl)-λ4-sulfanylidene]phosphane |
| PubChem CID | 59912307 |
| Molecular Formula | C4H11PS |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.03 |
| IUPAC Name | [methyl(propyl)-λ4-sulfanylidene]phosphane |
| SMILES | [H]/P=S(\C)CCC |
| InChI | InChI=1S/C4H11PS/c1-3-4-6(2)5/h5H,3-4H2,1-2H3 |
| InChIKey | RRGWTXKKKFSGQG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methyl(propyl)-λ4-sulfanylidene]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl(propyl)-λ4-sulfanylidene]phosphane?
The IUPAC name of [methyl(propyl)-λ4-sulfanylidene]phosphane (CID 59912307) is [methyl(propyl)-λ4-sulfanylidene]phosphane.
What is the SMILES notation for [methyl(propyl)-λ4-sulfanylidene]phosphane?
The canonical SMILES for [methyl(propyl)-λ4-sulfanylidene]phosphane is [H]/P=S(\C)CCC.
What is the InChIKey of [methyl(propyl)-λ4-sulfanylidene]phosphane?
The InChIKey is RRGWTXKKKFSGQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11PS/c1-3-4-6(2)5/h5H,3-4H2,1-2H3.
What are the key properties of [methyl(propyl)-λ4-sulfanylidene]phosphane?
[methyl(propyl)-λ4-sulfanylidene]phosphane has a molecular weight of 122.17 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl(propyl)-λ4-sulfanylidene]phosphane is sourced from PubChem (CID 59912307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).