About CID 59912313
CID 59912313 (PubChem CID 59912313) has the molecular formula C12H9BN2O2
and a molecular weight of 224.03 g/mol.
Molecular Properties
| Compound Name | CID 59912313 |
| PubChem CID | 59912313 |
| Molecular Formula | C12H9BN2O2 |
| Molecular Weight | 224.03 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | — |
| SMILES | [B]C(=O)Nc1ccc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C12H9BN2O2/c13-12(17)15-10-7-6-9(14-11(10)16)8-4-2-1-3-5-8/h1-7H,(H,14,16)(H,15,17) |
| InChIKey | HAGMKAHBSHCORV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.03 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 59912313 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59912313?
The IUPAC name of CID 59912313 (CID 59912313) is not available.
What is the SMILES notation for CID 59912313?
The canonical SMILES for CID 59912313 is [B]C(=O)Nc1ccc(-c2ccccc2)[nH]c1=O.
What is the InChIKey of CID 59912313?
The InChIKey is HAGMKAHBSHCORV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BN2O2/c13-12(17)15-10-7-6-9(14-11(10)16)8-4-2-1-3-5-8/h1-7H,(H,14,16)(H,15,17).
What are the key properties of CID 59912313?
CID 59912313 has a molecular weight of 224.03 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59912313 is sourced from PubChem (CID 59912313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).