C17H13N3O6 — CID 59912490
6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate (PubChem CID 59912490) has the molecular formula C17H13N3O6 and a molecular weight of 355.31 g/mol. Its IUPAC name is 6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate.
| Compound Name | 6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate |
|---|---|
| PubChem CID | 59912490 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-O-methyl 1-O-(4-nitrophenyl) 4-methylindazole-1,6-dicarboxylate |
| SMILES | COC(=O)c1cc(C)c2cnn(C(=O)Oc3ccc([N+](=O)[O-])cc3)c2c1 |
| InChI | InChI=1S/C17H13N3O6/c1-10-7-11(16(21)25-2)8-15-14(10)9-18-19(15)17(22)26-13-5-3-12(4-6-13)20(23)24/h3-9H,1-2H3 |
| InChIKey | VSVVKPQYDGSUCU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|