C16H32O5Si — CID 59912935
(3aS,4R,6R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol (PubChem CID 59912935) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (3aS,4R,6R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol.
| Compound Name | (3aS,4R,6R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol |
|---|---|
| PubChem CID | 59912935 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3aS,4R,6R,7aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-4,6-diol |
| SMILES | CC1(C)O[C@H]2[C@H](O)C[C@](O)(CO[Si](C)(C)C(C)(C)C)C[C@H]2O1 |
| InChI | InChI=1S/C16H32O5Si/c1-14(2,3)22(6,7)19-10-16(18)8-11(17)13-12(9-16)20-15(4,5)21-13/h11-13,17-18H,8-10H2,1-7H3/t11-,12-,13+,16-/m1/s1 |
| InChIKey | MMKGVFMPFRMAIH-NFFDBFGFSA-N |
| XLogP | 2.41 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|