C9H18BF3N2O4 — CID 59913057
N-[6-hydroperoxy-5-[(2,2,2-trifluoroacetyl)amino]hexyl]-methylboronamidic acid (PubChem CID 59913057) has the molecular formula C9H18BF3N2O4 and a molecular weight of 286.06 g/mol. Its IUPAC name is N-[6-hydroperoxy-5-[(2,2,2-trifluoroacetyl)amino]hexyl]-methylboronamidic acid.
| Compound Name | N-[6-hydroperoxy-5-[(2,2,2-trifluoroacetyl)amino]hexyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 59913057 |
| Molecular Formula | C9H18BF3N2O4 |
| Molecular Weight | 286.06 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[6-hydroperoxy-5-[(2,2,2-trifluoroacetyl)amino]hexyl]-methylboronamidic acid |
| SMILES | CB(O)NCCCCC(COO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H18BF3N2O4/c1-10(17)14-5-3-2-4-7(6-19-18)15-8(16)9(11,12)13/h7,14,17-18H,2-6H2,1H3,(H,15,16) |
| InChIKey | WCTYCNCXONCTAB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.06 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|