C32H33N2O2S+ — CID 59913715
(2Z)-2-[(2E,4E)-3-ethyl-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole (PubChem CID 59913715) has the molecular formula C32H33N2O2S+ and a molecular weight of 509.70 g/mol. Its IUPAC name is (2Z)-2-[(2E,4E)-3-ethyl-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole.
| Compound Name | (2Z)-2-[(2E,4E)-3-ethyl-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 59913715 |
| Molecular Formula | C32H33N2O2S+ |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2Z)-2-[(2E,4E)-3-ethyl-5-(4-methylbenzo[f]quinolin-4-ium-1-yl)penta-2,4-dienylidene]-5-methylsulfinyl-3-propyl-1,3-benzoxazole |
| SMILES | CCCN1/C(=C/C=C(/C=C/c2cc[n+](C)c3ccc4ccccc4c23)CC)Oc2ccc(S(C)=O)cc21 |
| InChI | InChI=1S/C32H33N2O2S/c1-5-20-34-29-22-26(37(4)35)15-17-30(29)36-31(34)18-12-23(6-2)11-13-25-19-21-33(3)28-16-14-24-9-7-8-10-27(24)32(25)28/h7-19,21-22H,5-6,20H2,1-4H3/q+1 |
| InChIKey | QEDWJSMZUSREKL-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|