C34H36N3O5S2+ — CID 59913716
ethylamino 3-[(2Z)-2-[(2E,4E)-3-methyl-5-(1-methylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-6-phenoxysulfanyl-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 59913716) has the molecular formula C34H36N3O5S2+ and a molecular weight of 630.81 g/mol. Its IUPAC name is ethylamino 3-[(2Z)-2-[(2E,4E)-3-methyl-5-(1-methylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-6-phenoxysulfanyl-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | ethylamino 3-[(2Z)-2-[(2E,4E)-3-methyl-5-(1-methylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-6-phenoxysulfanyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59913716 |
| Molecular Formula | C34H36N3O5S2+ |
| Molecular Weight | 630.81 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | ethylamino 3-[(2Z)-2-[(2E,4E)-3-methyl-5-(1-methylquinolin-1-ium-4-yl)penta-2,4-dienylidene]-6-phenoxysulfanyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | CCNOS(=O)(=O)CCCN1/C(=C/C=C(C)/C=C/c2cc[n+](C)c3ccccc23)Oc2cc(SOc3ccccc3)ccc21 |
| InChI | InChI=1S/C34H36N3O5S2/c1-4-35-42-44(38,39)24-10-22-37-32-19-18-29(43-41-28-11-6-5-7-12-28)25-33(32)40-34(37)20-16-26(2)15-17-27-21-23-36(3)31-14-9-8-13-30(27)31/h5-9,11-21,23,25,35H,4,10,22,24H2,1-3H3/q+1 |
| InChIKey | ZBUIDDCGHXNXJW-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.81 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|