C6H11N2O2Rf- — CID 59913948
(2-acetamido-2-methylpropanoyl)azanide;rutherfordium (PubChem CID 59913948) has the molecular formula C6H11N2O2Rf- and a molecular weight of 410.17 g/mol. Its IUPAC name is (2-acetamido-2-methylpropanoyl)azanide;rutherfordium.
| Compound Name | (2-acetamido-2-methylpropanoyl)azanide;rutherfordium |
|---|---|
| PubChem CID | 59913948 |
| Molecular Formula | C6H11N2O2Rf- |
| Molecular Weight | 410.17 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (2-acetamido-2-methylpropanoyl)azanide;rutherfordium |
| SMILES | CC(=O)NC(C)(C)C([NH-])=O.[Rf] |
| InChI | InChI=1S/C6H12N2O2.Rf/c1-4(9)8-6(2,3)5(7)10;/h1-3H3,(H3,7,8,9,10);/p-1 |
| InChIKey | NDVWZAUONOMBMY-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |