About (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide
(2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide (PubChem CID 59913952) has the molecular formula C28H38F2N2O
and a molecular weight of 456.62 g/mol. Its IUPAC name is (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide.
Molecular Properties
| Compound Name | (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide |
| PubChem CID | 59913952 |
| Molecular Formula | C28H38F2N2O |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C1CCCCC1 |
| InChI | InChI=1S/C28H38F2N2O/c1-20(2)27(32(3)25-8-5-4-6-9-25)28(33)31-19-7-10-26(21-11-15-23(29)16-12-21)22-13-17-24(30)18-14-22/h11-18,20,25-27H,4-10,19H2,1-3H3,(H,31,33)/t27-/m0/s1 |
| InChIKey | XAKRRZRNEKBJIP-MHZLTWQESA-N |
| XLogP | 6.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide?
The IUPAC name of (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide (CID 59913952) is (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide.
What is the SMILES notation for (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide?
The canonical SMILES for (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide is CC(C)[C@@H](C(=O)NCCCC(c1ccc(F)cc1)c1ccc(F)cc1)N(C)C1CCCCC1.
What is the InChIKey of (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide?
The InChIKey is XAKRRZRNEKBJIP-MHZLTWQESA-N. The full InChI is InChI=1S/C28H38F2N2O/c1-20(2)27(32(3)25-8-5-4-6-9-25)28(33)31-19-7-10-26(21-11-15-23(29)16-12-21)22-13-17-24(30)18-14-22/h11-18,20,25-27H,4-10,19H2,1-3H3,(H,31,33)/t27-/m0/s1.
What are the key properties of (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide?
(2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide has a molecular weight of 456.62 g/mol, XLogP of 6.28, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[4,4-bis(4-fluorophenyl)butyl]-2-[cyclohexyl(methyl)amino]-3-methylbutanamide is sourced from PubChem (CID 59913952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).