C20H36N2O6 — CID 59914944
2-methoxyethyl (2R)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate (PubChem CID 59914944) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-methoxyethyl (2R)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate.
| Compound Name | 2-methoxyethyl (2R)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 59914944 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-methoxyethyl (2R)-2-[[(2R,3S)-3-(hydroxycarbamoyl)-2-(2-methylpropyl)hex-5-enoyl]amino]-3,3-dimethylbutanoate |
| SMILES | C=CC[C@H](C(=O)NO)[C@@H](CC(C)C)C(=O)N[C@@H](C(=O)OCCOC)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O6/c1-8-9-14(18(24)22-26)15(12-13(2)3)17(23)21-16(20(4,5)6)19(25)28-11-10-27-7/h8,13-16,26H,1,9-12H2,2-7H3,(H,21,23)(H,22,24)/t14-,15+,16-/m0/s1 |
| InChIKey | RSHWLZSMOVRAJD-XHSDSOJGSA-N |
| XLogP | 2.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|