C29H54N2O5 — CID 59915332
10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate (PubChem CID 59915332) has the molecular formula C29H54N2O5 and a molecular weight of 510.76 g/mol. Its IUPAC name is 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate.
| Compound Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 59915332 |
| Molecular Formula | C29H54N2O5 |
| Molecular Weight | 510.76 g/mol |
| Exact Mass | 510.40 |
| IUPAC Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) decanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C29H54N2O5/c1-26(2)18-22(19-27(3,4)30(26)9)35-24(32)16-14-12-10-11-13-15-17-25(33)36-23-20-28(5,6)31(34)29(7,8)21-23/h22-23,34H,10-21H2,1-9H3 |
| InChIKey | UGJIWJBMKUHADY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.76 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|