C29H35N3OS — CID 59915415
(NE)-N-[4-[5-(1-benzothiophen-7-yl)-2,3,4,7-tetrahydroazepin-1-yl]-1-cyclohexyl-2-pyridin-2-ylbutylidene]hydroxylamine (PubChem CID 59915415) has the molecular formula C29H35N3OS and a molecular weight of 473.69 g/mol. Its IUPAC name is (NE)-N-[4-[5-(1-benzothiophen-7-yl)-2,3,4,7-tetrahydroazepin-1-yl]-1-cyclohexyl-2-pyridin-2-ylbutylidene]hydroxylamine.
| Compound Name | (NE)-N-[4-[5-(1-benzothiophen-7-yl)-2,3,4,7-tetrahydroazepin-1-yl]-1-cyclohexyl-2-pyridin-2-ylbutylidene]hydroxylamine |
|---|---|
| PubChem CID | 59915415 |
| Molecular Formula | C29H35N3OS |
| Molecular Weight | 473.69 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (NE)-N-[4-[5-(1-benzothiophen-7-yl)-2,3,4,7-tetrahydroazepin-1-yl]-1-cyclohexyl-2-pyridin-2-ylbutylidene]hydroxylamine |
| SMILES | O/N=C(\C1CCCCC1)C(CCN1CC=C(c2cccc3ccsc23)CCC1)c1ccccn1 |
| InChI | InChI=1S/C29H35N3OS/c33-31-28(23-8-2-1-3-9-23)26(27-13-4-5-17-30-27)15-20-32-18-7-11-22(14-19-32)25-12-6-10-24-16-21-34-29(24)25/h4-6,10,12-14,16-17,21,23,26,33H,1-3,7-9,11,15,18-20H2/b31-28+ |
| InChIKey | VQUYYKBOWXYVNX-CCFHIKDMSA-N |
| XLogP | 7.36 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.69 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|