About bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione
bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione (PubChem CID 59915551) has the molecular formula C13H14N4S3
and a molecular weight of 322.48 g/mol. Its IUPAC name is bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione.
Molecular Properties
| Compound Name | bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione |
| PubChem CID | 59915551 |
| Molecular Formula | C13H14N4S3 |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione |
| SMILES | Cc1cc(C)nc(SC(=S)Sc2nc(C)cc(C)n2)n1 |
| InChI | InChI=1S/C13H14N4S3/c1-7-5-8(2)15-11(14-7)19-13(18)20-12-16-9(3)6-10(4)17-12/h5-6H,1-4H3 |
| InChIKey | ABPRYKOGBQYHNM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione?
The IUPAC name of bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione (CID 59915551) is bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione.
What is the SMILES notation for bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione?
The canonical SMILES for bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione is Cc1cc(C)nc(SC(=S)Sc2nc(C)cc(C)n2)n1.
What is the InChIKey of bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione?
The InChIKey is ABPRYKOGBQYHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4S3/c1-7-5-8(2)15-11(14-7)19-13(18)20-12-16-9(3)6-10(4)17-12/h5-6H,1-4H3.
What are the key properties of bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione?
bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione has a molecular weight of 322.48 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(4,6-dimethylpyrimidin-2-yl)sulfanyl]methanethione is sourced from PubChem (CID 59915551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).