C28H20Cl2N4O3 — CID 59915981
4-[(E)-N-[[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]amino]-C-methylcarbonimidoyl]benzoic acid (PubChem CID 59915981) has the molecular formula C28H20Cl2N4O3 and a molecular weight of 531.40 g/mol. Its IUPAC name is 4-[(E)-N-[[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]amino]-C-methylcarbonimidoyl]benzoic acid.
| Compound Name | 4-[(E)-N-[[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]amino]-C-methylcarbonimidoyl]benzoic acid |
|---|---|
| PubChem CID | 59915981 |
| Molecular Formula | C28H20Cl2N4O3 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 4-[(E)-N-[[9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carbonyl]amino]-C-methylcarbonimidoyl]benzoic acid |
| SMILES | C/C(=N\NC(=O)c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C28H20Cl2N4O3/c1-16(17-6-8-18(9-7-17)28(36)37)32-33-27(35)24-13-22-21-4-2-3-5-25(21)34(26(22)14-31-24)15-19-12-20(29)10-11-23(19)30/h2-14H,15H2,1H3,(H,33,35)(H,36,37)/b32-16+ |
| InChIKey | KAIYIXFJCMHORX-KPGMTVGESA-N |
| XLogP | 6.40 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|