C22H25N3O5 — CID 59916185
nitrooxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate (PubChem CID 59916185) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is nitrooxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate.
| Compound Name | nitrooxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate |
|---|---|
| PubChem CID | 59916185 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | nitrooxymethyl 3-methyl-11,12,14,15,16,17,20,21-octahydro-1H-yohimban-19-carboxylate |
| SMILES | Cn1c2c(c3ccccc31)CCN1CC3CCC=C(C(=O)OCO[N+](=O)[O-])C3CC21 |
| InChI | InChI=1S/C22H25N3O5/c1-23-19-8-3-2-6-15(19)16-9-10-24-12-14-5-4-7-17(18(14)11-20(24)21(16)23)22(26)29-13-30-25(27)28/h2-3,6-8,14,18,20H,4-5,9-13H2,1H3 |
| InChIKey | HXVMPVYVGRBRCM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|