C31H56O7Si2 — CID 59916225
2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methoxyphenyl)methoxymethyl]oxolan-2-yl]acetaldehyde (PubChem CID 59916225) has the molecular formula C31H56O7Si2 and a molecular weight of 596.95 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methoxyphenyl)methoxymethyl]oxolan-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methoxyphenyl)methoxymethyl]oxolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 59916225 |
| Molecular Formula | C31H56O7Si2 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxy-3-[(4-methoxyphenyl)methoxymethyl]oxolan-2-yl]acetaldehyde |
| SMILES | COc1ccc(COC[C@@H]2[C@@H](OC)[C@@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@H]2CC=O)cc1 |
| InChI | InChI=1S/C31H56O7Si2/c1-30(2,3)39(9,10)36-21-25(38-40(11,12)31(4,5)6)19-28-29(34-8)26(27(37-28)17-18-32)22-35-20-23-13-15-24(33-7)16-14-23/h13-16,18,25-29H,17,19-22H2,1-12H3/t25-,26-,27-,28+,29+/m0/s1 |
| InChIKey | PMNXFNDEKYOKMF-OTJWULCMSA-N |
| XLogP | 7.00 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|