C22H41F3O6Si — CID 59916226
2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-hydroxy-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 59916226) has the molecular formula C22H41F3O6Si and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-hydroxy-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-hydroxy-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59916226 |
| Molecular Formula | C22H41F3O6Si |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-hydroxy-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](CCOC(=O)C(C)(C)C)O[C@@H]1CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C22H41F3O6Si/c1-20(2,3)19(27)29-13-12-14-17(26)18(28-7)15(30-14)10-11-16(22(23,24)25)31-32(8,9)21(4,5)6/h14-18,26H,10-13H2,1-9H3/t14-,15+,16?,17-,18-/m0/s1 |
| InChIKey | RJGKPSOTAUQYII-MPBYHJMHSA-N |
| XLogP | 4.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|