C25H41F3O6Si — CID 59916244
2-[(2S,3S,4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]ethanol (PubChem CID 59916244) has the molecular formula C25H41F3O6Si and a molecular weight of 522.68 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]ethanol.
| Compound Name | 2-[(2S,3S,4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 59916244 |
| Molecular Formula | C25H41F3O6Si |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 2-[(2S,3S,4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-4-methoxy-3-[(4-methoxyphenyl)methoxy]oxolan-2-yl]ethanol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](OC)[C@@H](CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F)O[C@H]2CCO)cc1 |
| InChI | InChI=1S/C25H41F3O6Si/c1-24(2,3)35(6,7)34-21(25(26,27)28)13-12-19-22(31-5)23(20(33-19)14-15-29)32-16-17-8-10-18(30-4)11-9-17/h8-11,19-23,29H,12-16H2,1-7H3/t19-,20+,21?,22+,23+/m1/s1 |
| InChIKey | QEXZAGHIIGAPRR-JURYYYOISA-N |
| XLogP | 5.48 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|