C34H63NO5Si2 — CID 59916841
[(7S,8S,8aR)-8-[(5R)-7-(butylamino)-7-oxo-3,5-bis(trimethylsilyloxy)heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 59916841) has the molecular formula C34H63NO5Si2 and a molecular weight of 622.05 g/mol. Its IUPAC name is [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-7-oxo-3,5-bis(trimethylsilyloxy)heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-7-oxo-3,5-bis(trimethylsilyloxy)heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 59916841 |
| Molecular Formula | C34H63NO5Si2 |
| Molecular Weight | 622.05 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | [(7S,8S,8aR)-8-[(5R)-7-(butylamino)-7-oxo-3,5-bis(trimethylsilyloxy)heptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCCCNC(=O)C[C@@H](CC(CC[C@@H]1[C@@H]2C(=CC(C)CC2OC(=O)C(C)CC)C=C[C@@H]1C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C34H63NO5Si2/c1-12-14-19-35-32(36)23-29(40-42(9,10)11)22-28(39-41(6,7)8)17-18-30-26(5)15-16-27-20-24(3)21-31(33(27)30)38-34(37)25(4)13-2/h15-16,20,24-26,28-31,33H,12-14,17-19,21-23H2,1-11H3,(H,35,36)/t24?,25?,26-,28?,29+,30-,31?,33-/m0/s1 |
| InChIKey | YDMBDMFCPDZKEG-VOGLYGCYSA-N |
| XLogP | 8.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.05 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|