About 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine
1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine (PubChem CID 59916929) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine |
| PubChem CID | 59916929 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine |
| SMILES | C=C1CC(C(C)C)C(=C)N1C |
| InChI | InChI=1S/C10H17N/c1-7(2)10-6-8(3)11(5)9(10)4/h7,10H,3-4,6H2,1-2,5H3 |
| InChIKey | OZLQQSPBSKFBJC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine?
The IUPAC name of 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine (CID 59916929) is 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine.
What is the SMILES notation for 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine?
The canonical SMILES for 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine is C=C1CC(C(C)C)C(=C)N1C.
What is the InChIKey of 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine?
The InChIKey is OZLQQSPBSKFBJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-7(2)10-6-8(3)11(5)9(10)4/h7,10H,3-4,6H2,1-2,5H3.
What are the key properties of 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine?
1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine has a molecular weight of 151.25 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,5-dimethylidene-3-propan-2-ylpyrrolidine is sourced from PubChem (CID 59916929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).