C12H21N — CID 59916936
3-butan-2-yl-1-ethyl-2,5-dimethylidenepyrrolidine (PubChem CID 59916936) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3-butan-2-yl-1-ethyl-2,5-dimethylidenepyrrolidine.
| Compound Name | 3-butan-2-yl-1-ethyl-2,5-dimethylidenepyrrolidine |
|---|---|
| PubChem CID | 59916936 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3-butan-2-yl-1-ethyl-2,5-dimethylidenepyrrolidine |
| SMILES | C=C1CC(C(C)CC)C(=C)N1CC |
| InChI | InChI=1S/C12H21N/c1-6-9(3)12-8-10(4)13(7-2)11(12)5/h9,12H,4-8H2,1-3H3 |
| InChIKey | XBAPCLVDNIGUPV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |