C25H30N4O3 — CID 59917568
1,7-diacetyl-4,9-dimethyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one (PubChem CID 59917568) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1,7-diacetyl-4,9-dimethyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one.
| Compound Name | 1,7-diacetyl-4,9-dimethyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one |
|---|---|
| PubChem CID | 59917568 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1,7-diacetyl-4,9-dimethyl-8,10-dipyridin-2-yl-4,9-diazabicyclo[5.3.1]undecan-11-one |
| SMILES | CC(=O)C12CCN(C)CCC(C(C)=O)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1 |
| InChI | InChI=1S/C25H30N4O3/c1-17(30)24-11-15-28(3)16-12-25(18(2)31,23(24)32)22(20-10-6-8-14-27-20)29(4)21(24)19-9-5-7-13-26-19/h5-10,13-14,21-22H,11-12,15-16H2,1-4H3 |
| InChIKey | HCKMKYSVBHGLTJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|