C37H46F6O4 — CID 59917927
(2-methyl-2-adamantyl) 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propyl]-4-(4-hydroxyphenyl)-2,4-dimethylhexanoate (PubChem CID 59917927) has the molecular formula C37H46F6O4 and a molecular weight of 668.76 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propyl]-4-(4-hydroxyphenyl)-2,4-dimethylhexanoate.
| Compound Name | (2-methyl-2-adamantyl) 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propyl]-4-(4-hydroxyphenyl)-2,4-dimethylhexanoate |
|---|---|
| PubChem CID | 59917927 |
| Molecular Formula | C37H46F6O4 |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propyl]-4-(4-hydroxyphenyl)-2,4-dimethylhexanoate |
| SMILES | CCC(C)(CC(C)(CC(C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)C(=O)OC1(C)C2CC3CC(C2)CC1C3)c1ccc(O)cc1 |
| InChI | InChI=1S/C37H46F6O4/c1-6-32(3,26-11-13-30(44)14-12-26)21-33(4,31(45)47-34(5)28-16-23-15-24(18-28)19-29(34)17-23)20-22(2)25-7-9-27(10-8-25)35(46,36(38,39)40)37(41,42)43/h7-14,22-24,28-29,44,46H,6,15-21H2,1-5H3 |
| InChIKey | YCMPVYHQDWMQDW-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |