About 1,4-ditert-butylpyrazine
1,4-ditert-butylpyrazine (PubChem CID 59918155) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 1,4-ditert-butylpyrazine.
Molecular Properties
| Compound Name | 1,4-ditert-butylpyrazine |
| PubChem CID | 59918155 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1,4-ditert-butylpyrazine |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C12H22N2/c1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H,1-6H3 |
| InChIKey | HMIOOYBMSDUBDB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-ditert-butylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butylpyrazine?
The IUPAC name of 1,4-ditert-butylpyrazine (CID 59918155) is 1,4-ditert-butylpyrazine.
What is the SMILES notation for 1,4-ditert-butylpyrazine?
The canonical SMILES for 1,4-ditert-butylpyrazine is CC(C)(C)N1C=CN(C(C)(C)C)C=C1.
What is the InChIKey of 1,4-ditert-butylpyrazine?
The InChIKey is HMIOOYBMSDUBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H,1-6H3.
What are the key properties of 1,4-ditert-butylpyrazine?
1,4-ditert-butylpyrazine has a molecular weight of 194.32 g/mol, XLogP of 3.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butylpyrazine is sourced from PubChem (CID 59918155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).