About 3-aminobenzene-4-id-1-ol;yttrium
3-aminobenzene-4-id-1-ol;yttrium (PubChem CID 59919049) has the molecular formula C6H6NOY-
and a molecular weight of 197.03 g/mol. Its IUPAC name is 3-aminobenzene-4-id-1-ol;yttrium.
Molecular Properties
| Compound Name | 3-aminobenzene-4-id-1-ol;yttrium |
| PubChem CID | 59919049 |
| Molecular Formula | C6H6NOY- |
| Molecular Weight | 197.03 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | 3-aminobenzene-4-id-1-ol;yttrium |
| SMILES | Nc1[c-]ccc(O)c1.[Y] |
| InChI | InChI=1S/C6H6NO.Y/c7-5-2-1-3-6(8)4-5;/h1,3-4,8H,7H2;/q-1; |
| InChIKey | JXNUJTDTILXEQJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.03 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-aminobenzene-4-id-1-ol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobenzene-4-id-1-ol;yttrium?
The IUPAC name of 3-aminobenzene-4-id-1-ol;yttrium (CID 59919049) is 3-aminobenzene-4-id-1-ol;yttrium.
What is the SMILES notation for 3-aminobenzene-4-id-1-ol;yttrium?
The canonical SMILES for 3-aminobenzene-4-id-1-ol;yttrium is Nc1[c-]ccc(O)c1.[Y].
What is the InChIKey of 3-aminobenzene-4-id-1-ol;yttrium?
The InChIKey is JXNUJTDTILXEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6NO.Y/c7-5-2-1-3-6(8)4-5;/h1,3-4,8H,7H2;/q-1;.
What are the key properties of 3-aminobenzene-4-id-1-ol;yttrium?
3-aminobenzene-4-id-1-ol;yttrium has a molecular weight of 197.03 g/mol, XLogP of 0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobenzene-4-id-1-ol;yttrium is sourced from PubChem (CID 59919049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).