C17H22O7S — CID 59919073
[(3aR,5R,6S,6aR)-5-(hydroxymethyl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclopentane]-6-yl] 4-methylbenzenesulfonate (PubChem CID 59919073) has the molecular formula C17H22O7S and a molecular weight of 370.42 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-5-(hydroxymethyl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclopentane]-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-5-(hydroxymethyl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclopentane]-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59919073 |
| Molecular Formula | C17H22O7S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(3aR,5R,6S,6aR)-5-(hydroxymethyl)spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclopentane]-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2[C@H]3OC4(CCCC4)O[C@H]3O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C17H22O7S/c1-11-4-6-12(7-5-11)25(19,20)24-14-13(10-18)21-16-15(14)22-17(23-16)8-2-3-9-17/h4-7,13-16,18H,2-3,8-10H2,1H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | VVKJBDYDNLACHP-QKPAOTATSA-N |
| XLogP | 1.47 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|