C38H33N2O2P — CID 59919108
bis[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-phenylphosphane (PubChem CID 59919108) has the molecular formula C38H33N2O2P and a molecular weight of 580.67 g/mol. Its IUPAC name is bis[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-phenylphosphane.
| Compound Name | bis[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-phenylphosphane |
|---|---|
| PubChem CID | 59919108 |
| Molecular Formula | C38H33N2O2P |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | bis[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]-phenylphosphane |
| SMILES | c1ccc([C@H]2N=C(CP(CC3=N[C@H](c4ccccc4)[C@H](c4ccccc4)O3)c3ccccc3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C38H33N2O2P/c1-6-16-28(17-7-1)35-37(30-20-10-3-11-21-30)41-33(39-35)26-43(32-24-14-5-15-25-32)27-34-40-36(29-18-8-2-9-19-29)38(42-34)31-22-12-4-13-23-31/h1-25,35-38H,26-27H2/t35-,36-,37+,38+/m1/s1 |
| InChIKey | OZZVGDVTAUMRIM-RNATXAOGSA-N |
| XLogP | 8.62 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|