About CID 59919151
CID 59919151 (PubChem CID 59919151) has the molecular formula C8H14NO4
and a molecular weight of 188.20 g/mol.
Molecular Properties
| Compound Name | CID 59919151 |
| PubChem CID | 59919151 |
| Molecular Formula | C8H14NO4 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | — |
| SMILES | CC1(C)COC(C)(CC(=O)O)N1[O] |
| InChI | InChI=1S/C8H14NO4/c1-7(2)5-13-8(3,9(7)12)4-6(10)11/h4-5H2,1-3H3,(H,10,11) |
| InChIKey | FKPSLKOUVRIDKI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59919151 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59919151?
The IUPAC name of CID 59919151 (CID 59919151) is not available.
What is the SMILES notation for CID 59919151?
The canonical SMILES for CID 59919151 is CC1(C)COC(C)(CC(=O)O)N1[O].
What is the InChIKey of CID 59919151?
The InChIKey is FKPSLKOUVRIDKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14NO4/c1-7(2)5-13-8(3,9(7)12)4-6(10)11/h4-5H2,1-3H3,(H,10,11).
What are the key properties of CID 59919151?
CID 59919151 has a molecular weight of 188.20 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59919151 is sourced from PubChem (CID 59919151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).