About CID 59919159
CID 59919159 (PubChem CID 59919159) has the molecular formula C11H20NO
and a molecular weight of 182.29 g/mol.
Molecular Properties
| Compound Name | CID 59919159 |
| PubChem CID | 59919159 |
| Molecular Formula | C11H20NO |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CCCCC2)N1[O] |
| InChI | InChI=1S/C11H20NO/c1-10(2)8-9-11(12(10)13)6-4-3-5-7-11/h3-9H2,1-2H3 |
| InChIKey | GICJNRPFWDYKHO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59919159 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59919159?
The IUPAC name of CID 59919159 (CID 59919159) is not available.
What is the SMILES notation for CID 59919159?
The canonical SMILES for CID 59919159 is CC1(C)CCC2(CCCCC2)N1[O].
What is the InChIKey of CID 59919159?
The InChIKey is GICJNRPFWDYKHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NO/c1-10(2)8-9-11(12(10)13)6-4-3-5-7-11/h3-9H2,1-2H3.
What are the key properties of CID 59919159?
CID 59919159 has a molecular weight of 182.29 g/mol, XLogP of 2.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59919159 is sourced from PubChem (CID 59919159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).