About (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate
(4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 59919535) has the molecular formula C23H27NO2
and a molecular weight of 349.47 g/mol. Its IUPAC name is (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| PubChem CID | 59919535 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2C3CC[C@H](C[C@@H]2c2ccc(C)cc2)N3C)cc1 |
| InChI | InChI=1S/C23H27NO2/c1-15-4-8-17(9-5-15)20-14-18-10-13-21(24(18)3)22(20)23(25)26-19-11-6-16(2)7-12-19/h4-9,11-12,18,20-22H,10,13-14H2,1-3H3/t18-,20-,21?,22?/m1/s1 |
| InChIKey | FGXZPRXFLNGHFB-JSFXGIFRSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate?
The IUPAC name of (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (CID 59919535) is (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
What is the SMILES notation for (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate?
The canonical SMILES for (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate is Cc1ccc(OC(=O)C2C3CC[C@H](C[C@@H]2c2ccc(C)cc2)N3C)cc1.
What is the InChIKey of (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate?
The InChIKey is FGXZPRXFLNGHFB-JSFXGIFRSA-N. The full InChI is InChI=1S/C23H27NO2/c1-15-4-8-17(9-5-15)20-14-18-10-13-21(24(18)3)22(20)23(25)26-19-11-6-16(2)7-12-19/h4-9,11-12,18,20-22H,10,13-14H2,1-3H3/t18-,20-,21?,22?/m1/s1.
What are the key properties of (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate?
(4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate has a molecular weight of 349.47 g/mol, XLogP of 4.48, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) (3S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate is sourced from PubChem (CID 59919535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).