About [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate
[(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate (PubChem CID 59919556) has the molecular formula C17H22ClNO3
and a molecular weight of 323.82 g/mol. Its IUPAC name is [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate.
Molecular Properties
| Compound Name | [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate |
| PubChem CID | 59919556 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate |
| SMILES | COC(=O)OCC1C2CC[C@H](C[C@@H]1c1ccc(Cl)cc1)N2C |
| InChI | InChI=1S/C17H22ClNO3/c1-19-13-7-8-16(19)15(10-22-17(20)21-2)14(9-13)11-3-5-12(18)6-4-11/h3-6,13-16H,7-10H2,1-2H3/t13-,14-,15?,16?/m1/s1 |
| InChIKey | PKOGPKLZEXPAJU-WXLSXGNJSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate?
The IUPAC name of [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate (CID 59919556) is [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate.
What is the SMILES notation for [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate?
The canonical SMILES for [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate is COC(=O)OCC1C2CC[C@H](C[C@@H]1c1ccc(Cl)cc1)N2C.
What is the InChIKey of [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate?
The InChIKey is PKOGPKLZEXPAJU-WXLSXGNJSA-N. The full InChI is InChI=1S/C17H22ClNO3/c1-19-13-7-8-16(19)15(10-22-17(20)21-2)14(9-13)11-3-5-12(18)6-4-11/h3-6,13-16H,7-10H2,1-2H3/t13-,14-,15?,16?/m1/s1.
What are the key properties of [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate?
[(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate has a molecular weight of 323.82 g/mol, XLogP of 3.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]methyl methyl carbonate is sourced from PubChem (CID 59919556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).