About propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 59919801) has the molecular formula C19H26ClNO2
and a molecular weight of 335.88 g/mol. Its IUPAC name is propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| PubChem CID | 59919801 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | Cc1cc(C2C[C@H]3CCC([C@H]2C(=O)OC(C)C)N3C)ccc1Cl |
| InChI | InChI=1S/C19H26ClNO2/c1-11(2)23-19(22)18-15(10-14-6-8-17(18)21(14)4)13-5-7-16(20)12(3)9-13/h5,7,9,11,14-15,17-18H,6,8,10H2,1-4H3/t14-,15?,17?,18+/m1/s1 |
| InChIKey | ILJJCKKGFBUAOR-RYKRPPSOSA-N |
| XLogP | 4.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate?
The IUPAC name of propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (CID 59919801) is propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
What is the SMILES notation for propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate?
The canonical SMILES for propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate is Cc1cc(C2C[C@H]3CCC([C@H]2C(=O)OC(C)C)N3C)ccc1Cl.
What is the InChIKey of propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate?
The InChIKey is ILJJCKKGFBUAOR-RYKRPPSOSA-N. The full InChI is InChI=1S/C19H26ClNO2/c1-11(2)23-19(22)18-15(10-14-6-8-17(18)21(14)4)13-5-7-16(20)12(3)9-13/h5,7,9,11,14-15,17-18H,6,8,10H2,1-4H3/t14-,15?,17?,18+/m1/s1.
What are the key properties of propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate?
propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate has a molecular weight of 335.88 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S,5R)-3-(4-chloro-3-methylphenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate is sourced from PubChem (CID 59919801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).