C19H24INO2 — CID 59919830
cyclobutyl (3S,5R)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 59919830) has the molecular formula C19H24INO2 and a molecular weight of 425.31 g/mol. Its IUPAC name is cyclobutyl (3S,5R)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | cyclobutyl (3S,5R)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 59919830 |
| Molecular Formula | C19H24INO2 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | cyclobutyl (3S,5R)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CN1C2CC[C@@H]1C[C@H](c1ccc(I)cc1)C2C(=O)OC1CCC1 |
| InChI | InChI=1S/C19H24INO2/c1-21-14-9-10-17(21)18(19(22)23-15-3-2-4-15)16(11-14)12-5-7-13(20)8-6-12/h5-8,14-18H,2-4,9-11H2,1H3/t14-,16-,17?,18?/m1/s1 |
| InChIKey | BSFVPKXDKWTNTQ-DVHLICQRSA-N |
| XLogP | 3.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|