About CID 59919910
CID 59919910 (PubChem CID 59919910) has the molecular formula C16H31N2O2
and a molecular weight of 283.44 g/mol.
Molecular Properties
| Compound Name | CID 59919910 |
| PubChem CID | 59919910 |
| Molecular Formula | C16H31N2O2 |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | — |
| SMILES | CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1[O] |
| InChI | InChI=1S/C16H31N2O2/c1-8-15(9-2)12-17(14(5,6)7)13(19)16(10-3,11-4)18(15)20/h8-12H2,1-7H3 |
| InChIKey | BLUSXVLKZTYYBC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59919910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59919910?
The IUPAC name of CID 59919910 (CID 59919910) is not available.
What is the SMILES notation for CID 59919910?
The canonical SMILES for CID 59919910 is CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1[O].
What is the InChIKey of CID 59919910?
The InChIKey is BLUSXVLKZTYYBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N2O2/c1-8-15(9-2)12-17(14(5,6)7)13(19)16(10-3,11-4)18(15)20/h8-12H2,1-7H3.
What are the key properties of CID 59919910?
CID 59919910 has a molecular weight of 283.44 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59919910 is sourced from PubChem (CID 59919910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).